C20H21F3N2O3 — CID 165341735
[3-[[butyl(methyl)carbamoyl]amino]phenyl] 3-(trifluoromethyl)benzoate (PubChem CID 165341735) has the molecular formula C20H21F3N2O3 and a molecular weight of 394.39 g/mol. Its IUPAC name is [3-[[butyl(methyl)carbamoyl]amino]phenyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [3-[[butyl(methyl)carbamoyl]amino]phenyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 165341735 |
| Molecular Formula | C20H21F3N2O3 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [3-[[butyl(methyl)carbamoyl]amino]phenyl] 3-(trifluoromethyl)benzoate |
| SMILES | CCCCN(C)C(=O)Nc1cccc(OC(=O)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H21F3N2O3/c1-3-4-11-25(2)19(27)24-16-9-6-10-17(13-16)28-18(26)14-7-5-8-15(12-14)20(21,22)23/h5-10,12-13H,3-4,11H2,1-2H3,(H,24,27) |
| InChIKey | HJUHRMSTRNVUPO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|