C18H20Br2N2O2S — CID 165341857
N-[(2-amino-3,5-dibromophenyl)methyl]-N-(4-hydroxycyclohexyl)thiophene-2-carboxamide (PubChem CID 165341857) has the molecular formula C18H20Br2N2O2S and a molecular weight of 488.25 g/mol. Its IUPAC name is N-[(2-amino-3,5-dibromophenyl)methyl]-N-(4-hydroxycyclohexyl)thiophene-2-carboxamide.
| Compound Name | N-[(2-amino-3,5-dibromophenyl)methyl]-N-(4-hydroxycyclohexyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 165341857 |
| Molecular Formula | C18H20Br2N2O2S |
| Molecular Weight | 488.25 g/mol |
| Exact Mass | 485.96 |
| IUPAC Name | N-[(2-amino-3,5-dibromophenyl)methyl]-N-(4-hydroxycyclohexyl)thiophene-2-carboxamide |
| SMILES | Nc1c(Br)cc(Br)cc1CN(C(=O)c1cccs1)C1CCC(O)CC1 |
| InChI | InChI=1S/C18H20Br2N2O2S/c19-12-8-11(17(21)15(20)9-12)10-22(13-3-5-14(23)6-4-13)18(24)16-2-1-7-25-16/h1-2,7-9,13-14,23H,3-6,10,21H2 |
| InChIKey | XYEBWVJLHBFDRM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.25 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|