About 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde
3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde (PubChem CID 165342378) has the molecular formula C14H12N4O3
and a molecular weight of 284.27 g/mol. Its IUPAC name is 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde.
Molecular Properties
| Compound Name | 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde |
| PubChem CID | 165342378 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde |
| SMILES | Cc1cc2nc3c(=O)n(C)c(=O)nc-3n(C)c2cc1C=O |
| InChI | InChI=1S/C14H12N4O3/c1-7-4-9-10(5-8(7)6-19)17(2)12-11(15-9)13(20)18(3)14(21)16-12/h4-6H,1-3H3 |
| InChIKey | CXKCMGQWHDUBMS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 86.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde?
The IUPAC name of 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde (CID 165342378) is 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde.
What is the SMILES notation for 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde?
The canonical SMILES for 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde is Cc1cc2nc3c(=O)n(C)c(=O)nc-3n(C)c2cc1C=O.
What is the InChIKey of 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde?
The InChIKey is CXKCMGQWHDUBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O3/c1-7-4-9-10(5-8(7)6-19)17(2)12-11(15-9)13(20)18(3)14(21)16-12/h4-6H,1-3H3.
What are the key properties of 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde?
3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde has a molecular weight of 284.27 g/mol, XLogP of 0.25, 1 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7,10-trimethyl-2,4-dioxobenzo[g]pteridine-8-carbaldehyde is sourced from PubChem (CID 165342378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).