C15H18N2O3 — CID 165342730
(2S,3S,4R,5R)-2-(4-aminonaphthalen-1-yl)-5-(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 165342730) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-(4-aminonaphthalen-1-yl)-5-(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2S,3S,4R,5R)-2-(4-aminonaphthalen-1-yl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 165342730 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (2S,3S,4R,5R)-2-(4-aminonaphthalen-1-yl)-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | Nc1ccc([C@@H]2N[C@H](CO)[C@@H](O)[C@H]2O)c2ccccc12 |
| InChI | InChI=1S/C15H18N2O3/c16-11-6-5-10(8-3-1-2-4-9(8)11)13-15(20)14(19)12(7-18)17-13/h1-6,12-15,17-20H,7,16H2/t12-,13+,14-,15+/m1/s1 |
| InChIKey | LTOACBHWPDVJOV-BARDWOONSA-N |
| XLogP | 0.15 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|