About N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine
N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine (PubChem CID 165343772) has the molecular formula C11H23N5
and a molecular weight of 225.34 g/mol. Its IUPAC name is N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine |
| PubChem CID | 165343772 |
| Molecular Formula | C11H23N5 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.20 |
| IUPAC Name | N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine |
| SMILES | CNCCCc1nc(NC(C)(C)C)nn1C |
| InChI | InChI=1S/C11H23N5/c1-11(2,3)14-10-13-9(16(5)15-10)7-6-8-12-4/h12H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | BNNRBMBFUWCHEB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine?
The IUPAC name of N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine (CID 165343772) is N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine.
What is the SMILES notation for N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine?
The canonical SMILES for N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine is CNCCCc1nc(NC(C)(C)C)nn1C.
What is the InChIKey of N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine?
The InChIKey is BNNRBMBFUWCHEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N5/c1-11(2,3)14-10-13-9(16(5)15-10)7-6-8-12-4/h12H,6-8H2,1-5H3,(H,14,15).
What are the key properties of N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine?
N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine has a molecular weight of 225.34 g/mol, XLogP of 1.18, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-methyl-5-[3-(methylamino)propyl]-1,2,4-triazol-3-amine is sourced from PubChem (CID 165343772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).