C9H4Br2Cl6 — CID 165344183
2,3-bis(bromomethyl)-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hepta-2,5-diene (PubChem CID 165344183) has the molecular formula C9H4Br2Cl6 and a molecular weight of 484.66 g/mol. Its IUPAC name is 2,3-bis(bromomethyl)-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2,3-bis(bromomethyl)-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 165344183 |
| Molecular Formula | C9H4Br2Cl6 |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 479.68 |
| IUPAC Name | 2,3-bis(bromomethyl)-1,4,5,6,7,7-hexachlorobicyclo[2.2.1]hepta-2,5-diene |
| SMILES | ClC1=C(Cl)C2(Cl)C(CBr)=C(CBr)C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C9H4Br2Cl6/c10-1-3-4(2-11)8(15)6(13)5(12)7(3,14)9(8,16)17/h1-2H2 |
| InChIKey | SDQLUEIYSYFCIC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|