C10H4F5N3 — CID 165344407
5-(cyanomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 165344407) has the molecular formula C10H4F5N3 and a molecular weight of 261.15 g/mol. Its IUPAC name is 5-(cyanomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 5-(cyanomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 165344407 |
| Molecular Formula | C10H4F5N3 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 5-(cyanomethyl)-6-(difluoromethyl)-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#CCc1c(C(F)F)ncc(C#N)c1C(F)(F)F |
| InChI | InChI=1S/C10H4F5N3/c11-9(12)8-6(1-2-16)7(10(13,14)15)5(3-17)4-18-8/h4,9H,1H2 |
| InChIKey | SFRGQGVCCUCYMJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |