About [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate
[(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate (PubChem CID 165344930) has the molecular formula C8H10N4O4
and a molecular weight of 226.19 g/mol. Its IUPAC name is [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate.
Molecular Properties
| Compound Name | [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate |
| PubChem CID | 165344930 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate |
| SMILES | C/N=C1\NC(=O)N(C)C(=O)C1=NOC(C)=O |
| InChI | InChI=1S/C8H10N4O4/c1-4(13)16-11-5-6(9-2)10-8(15)12(3)7(5)14/h1-3H3,(H,9,10,15) |
| InChIKey | OJRBKJKZKPFZCQ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate?
The IUPAC name of [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate (CID 165344930) is [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate.
What is the SMILES notation for [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate?
The canonical SMILES for [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate is C/N=C1\NC(=O)N(C)C(=O)C1=NOC(C)=O.
What is the InChIKey of [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate?
The InChIKey is OJRBKJKZKPFZCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O4/c1-4(13)16-11-5-6(9-2)10-8(15)12(3)7(5)14/h1-3H3,(H,9,10,15).
What are the key properties of [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate?
[(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate has a molecular weight of 226.19 g/mol, XLogP of -0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1-methyl-4-methylimino-2,6-dioxo-1,3-diazinan-5-ylidene)amino] acetate is sourced from PubChem (CID 165344930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).