About 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one
6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one (PubChem CID 165344986) has the molecular formula C11H7BrClN3O
and a molecular weight of 312.55 g/mol. Its IUPAC name is 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one.
Molecular Properties
| Compound Name | 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one |
| PubChem CID | 165344986 |
| Molecular Formula | C11H7BrClN3O |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 310.95 |
| IUPAC Name | 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one |
| SMILES | Cc1cc(Br)c2[nH]c3c(=O)[nH]nc(Cl)c3c2c1 |
| InChI | InChI=1S/C11H7BrClN3O/c1-4-2-5-7-9(11(17)16-15-10(7)13)14-8(5)6(12)3-4/h2-3,14H,1H3,(H,16,17) |
| InChIKey | LIANXEFKQNTRRY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one?
The IUPAC name of 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one (CID 165344986) is 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one.
What is the SMILES notation for 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one?
The canonical SMILES for 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one is Cc1cc(Br)c2[nH]c3c(=O)[nH]nc(Cl)c3c2c1.
What is the InChIKey of 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one?
The InChIKey is LIANXEFKQNTRRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrClN3O/c1-4-2-5-7-9(11(17)16-15-10(7)13)14-8(5)6(12)3-4/h2-3,14H,1H3,(H,16,17).
What are the key properties of 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one?
6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one has a molecular weight of 312.55 g/mol, XLogP of 3.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-chloro-8-methyl-3,5-dihydropyridazino[4,5-b]indol-4-one is sourced from PubChem (CID 165344986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).