About 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol
2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol (PubChem CID 165345373) has the molecular formula C10H10N4O2S
and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol.
Molecular Properties
| Compound Name | 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol |
| PubChem CID | 165345373 |
| Molecular Formula | C10H10N4O2S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol |
| SMILES | COc1cc(/N=N/c2nc(C)ns2)ccc1O |
| InChI | InChI=1S/C10H10N4O2S/c1-6-11-10(17-14-6)13-12-7-3-4-8(15)9(5-7)16-2/h3-5,15H,1-2H3/b13-12+ |
| InChIKey | VENFADLBEAKLRQ-OUKQBFOZSA-N |
| XLogP | 2.98 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol?
The IUPAC name of 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol (CID 165345373) is 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol.
What is the SMILES notation for 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol?
The canonical SMILES for 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol is COc1cc(/N=N/c2nc(C)ns2)ccc1O.
What is the InChIKey of 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol?
The InChIKey is VENFADLBEAKLRQ-OUKQBFOZSA-N. The full InChI is InChI=1S/C10H10N4O2S/c1-6-11-10(17-14-6)13-12-7-3-4-8(15)9(5-7)16-2/h3-5,15H,1-2H3/b13-12+.
What are the key properties of 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol?
2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol has a molecular weight of 250.28 g/mol, XLogP of 2.98, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]phenol is sourced from PubChem (CID 165345373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).