About 2-(2-butyloctoxy)ethanol
2-(2-butyloctoxy)ethanol (PubChem CID 165345839) has the molecular formula C14H30O2
and a molecular weight of 230.39 g/mol. Its IUPAC name is 2-(2-butyloctoxy)ethanol.
Molecular Properties
| Compound Name | 2-(2-butyloctoxy)ethanol |
| PubChem CID | 165345839 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 2-(2-butyloctoxy)ethanol |
| SMILES | CCCCCCC(CCCC)COCCO |
| InChI | InChI=1S/C14H30O2/c1-3-5-7-8-10-14(9-6-4-2)13-16-12-11-15/h14-15H,3-13H2,1-2H3 |
| InChIKey | JLXNHGNJNWKTFI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butyloctoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butyloctoxy)ethanol?
The IUPAC name of 2-(2-butyloctoxy)ethanol (CID 165345839) is 2-(2-butyloctoxy)ethanol.
What is the SMILES notation for 2-(2-butyloctoxy)ethanol?
The canonical SMILES for 2-(2-butyloctoxy)ethanol is CCCCCCC(CCCC)COCCO.
What is the InChIKey of 2-(2-butyloctoxy)ethanol?
The InChIKey is JLXNHGNJNWKTFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O2/c1-3-5-7-8-10-14(9-6-4-2)13-16-12-11-15/h14-15H,3-13H2,1-2H3.
What are the key properties of 2-(2-butyloctoxy)ethanol?
2-(2-butyloctoxy)ethanol has a molecular weight of 230.39 g/mol, XLogP of 3.77, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butyloctoxy)ethanol is sourced from PubChem (CID 165345839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).