About 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene
4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene (PubChem CID 165347487) has the molecular formula C15H22O2S
and a molecular weight of 266.41 g/mol. Its IUPAC name is 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene |
| PubChem CID | 165347487 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene |
| SMILES | CCOC(CSc1cccc2c1CCC2)OCC |
| InChI | InChI=1S/C15H22O2S/c1-3-16-15(17-4-2)11-18-14-10-6-8-12-7-5-9-13(12)14/h6,8,10,15H,3-5,7,9,11H2,1-2H3 |
| InChIKey | JSBNSNXSNQHAHU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene?
The IUPAC name of 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene (CID 165347487) is 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene.
What is the SMILES notation for 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene?
The canonical SMILES for 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene is CCOC(CSc1cccc2c1CCC2)OCC.
What is the InChIKey of 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene?
The InChIKey is JSBNSNXSNQHAHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2S/c1-3-16-15(17-4-2)11-18-14-10-6-8-12-7-5-9-13(12)14/h6,8,10,15H,3-5,7,9,11H2,1-2H3.
What are the key properties of 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene?
4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene has a molecular weight of 266.41 g/mol, XLogP of 3.67, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-diethoxyethylsulfanyl)-2,3-dihydro-1H-indene is sourced from PubChem (CID 165347487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).