C11H25NO2 — CID 165348363
1,5-dimethoxy-2-methyl-N-propylpentan-3-amine (PubChem CID 165348363) has the molecular formula C11H25NO2 and a molecular weight of 203.33 g/mol. Its IUPAC name is 1,5-dimethoxy-2-methyl-N-propylpentan-3-amine.
| Compound Name | 1,5-dimethoxy-2-methyl-N-propylpentan-3-amine |
|---|---|
| PubChem CID | 165348363 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | 1,5-dimethoxy-2-methyl-N-propylpentan-3-amine |
| SMILES | CCCNC(CCOC)C(C)COC |
| InChI | InChI=1S/C11H25NO2/c1-5-7-12-11(6-8-13-3)10(2)9-14-4/h10-12H,5-9H2,1-4H3 |
| InChIKey | NSFYTASJOJNBST-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |