C22H24Br2O2 — CID 165348518
1,6-bis[4-(2-bromoethyl)phenyl]hexane-1,6-dione (PubChem CID 165348518) has the molecular formula C22H24Br2O2 and a molecular weight of 480.24 g/mol. Its IUPAC name is 1,6-bis[4-(2-bromoethyl)phenyl]hexane-1,6-dione.
| Compound Name | 1,6-bis[4-(2-bromoethyl)phenyl]hexane-1,6-dione |
|---|---|
| PubChem CID | 165348518 |
| Molecular Formula | C22H24Br2O2 |
| Molecular Weight | 480.24 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | 1,6-bis[4-(2-bromoethyl)phenyl]hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)c1ccc(CCBr)cc1)c1ccc(CCBr)cc1 |
| InChI | InChI=1S/C22H24Br2O2/c23-15-13-17-5-9-19(10-6-17)21(25)3-1-2-4-22(26)20-11-7-18(8-12-20)14-16-24/h5-12H,1-4,13-16H2 |
| InChIKey | HYHWIQDMLBAPEU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.24 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|