About 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid
4-(4,4,4-trifluorobut-2-ynyl)benzoic acid (PubChem CID 165348708) has the molecular formula C11H7F3O2
and a molecular weight of 228.17 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid |
| PubChem CID | 165348708 |
| Molecular Formula | C11H7F3O2 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid |
| SMILES | O=C(O)c1ccc(CC#CC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H7F3O2/c12-11(13,14)7-1-2-8-3-5-9(6-4-8)10(15)16/h3-6H,2H2,(H,15,16) |
| InChIKey | SGBFIOOYXHTQAS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid?
The IUPAC name of 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid (CID 165348708) is 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid.
What is the SMILES notation for 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid?
The canonical SMILES for 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid is O=C(O)c1ccc(CC#CC(F)(F)F)cc1.
What is the InChIKey of 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid?
The InChIKey is SGBFIOOYXHTQAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7F3O2/c12-11(13,14)7-1-2-8-3-5-9(6-4-8)10(15)16/h3-6H,2H2,(H,15,16).
What are the key properties of 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid?
4-(4,4,4-trifluorobut-2-ynyl)benzoic acid has a molecular weight of 228.17 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4,4-trifluorobut-2-ynyl)benzoic acid is sourced from PubChem (CID 165348708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).