C10H11NO2 — CID 165348779
2-methyl-4,5,6,7-tetrahydroquinoline-3,8-dione (PubChem CID 165348779) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydroquinoline-3,8-dione.
| Compound Name | 2-methyl-4,5,6,7-tetrahydroquinoline-3,8-dione |
|---|---|
| PubChem CID | 165348779 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2-methyl-4,5,6,7-tetrahydroquinoline-3,8-dione |
| SMILES | CC1=NC2=C(CCCC2=O)CC1=O |
| InChI | InChI=1S/C10H11NO2/c1-6-9(13)5-7-3-2-4-8(12)10(7)11-6/h2-5H2,1H3 |
| InChIKey | SXJIGFMJPJRRKX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |