About 1-cyclohexyl-4,5-diphenyltriazole
1-cyclohexyl-4,5-diphenyltriazole (PubChem CID 165349356) has the molecular formula C20H21N3
and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-cyclohexyl-4,5-diphenyltriazole.
Molecular Properties
| Compound Name | 1-cyclohexyl-4,5-diphenyltriazole |
| PubChem CID | 165349356 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-cyclohexyl-4,5-diphenyltriazole |
| SMILES | c1ccc(-c2nnn(C3CCCCC3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N3/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)23(22-21-19)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2 |
| InChIKey | WTMURWJMHQWDHM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-4,5-diphenyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4,5-diphenyltriazole?
The IUPAC name of 1-cyclohexyl-4,5-diphenyltriazole (CID 165349356) is 1-cyclohexyl-4,5-diphenyltriazole.
What is the SMILES notation for 1-cyclohexyl-4,5-diphenyltriazole?
The canonical SMILES for 1-cyclohexyl-4,5-diphenyltriazole is c1ccc(-c2nnn(C3CCCCC3)c2-c2ccccc2)cc1.
What is the InChIKey of 1-cyclohexyl-4,5-diphenyltriazole?
The InChIKey is WTMURWJMHQWDHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3/c1-4-10-16(11-5-1)19-20(17-12-6-2-7-13-17)23(22-21-19)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2.
What are the key properties of 1-cyclohexyl-4,5-diphenyltriazole?
1-cyclohexyl-4,5-diphenyltriazole has a molecular weight of 303.41 g/mol, XLogP of 5.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4,5-diphenyltriazole is sourced from PubChem (CID 165349356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).