C9H7BrFN3 — CID 165349587
6-bromo-5-fluoro-N-methylquinazolin-2-amine (PubChem CID 165349587) has the molecular formula C9H7BrFN3 and a molecular weight of 256.08 g/mol. Its IUPAC name is 6-bromo-5-fluoro-N-methylquinazolin-2-amine.
| Compound Name | 6-bromo-5-fluoro-N-methylquinazolin-2-amine |
|---|---|
| PubChem CID | 165349587 |
| Molecular Formula | C9H7BrFN3 |
| Molecular Weight | 256.08 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | 6-bromo-5-fluoro-N-methylquinazolin-2-amine |
| SMILES | CNc1ncc2c(F)c(Br)ccc2n1 |
| InChI | InChI=1S/C9H7BrFN3/c1-12-9-13-4-5-7(14-9)3-2-6(10)8(5)11/h2-4H,1H3,(H,12,13,14) |
| InChIKey | JCGASBDUBSJRSM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.08 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |