About (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone
(5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone (PubChem CID 165351345) has the molecular formula C13H8ClN3OS
and a molecular weight of 289.75 g/mol. Its IUPAC name is (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone.
Molecular Properties
| Compound Name | (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone |
| PubChem CID | 165351345 |
| Molecular Formula | C13H8ClN3OS |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone |
| SMILES | Nc1c(C(=O)c2ccc(Cl)cc2)sc2ncncc12 |
| InChI | InChI=1S/C13H8ClN3OS/c14-8-3-1-7(2-4-8)11(18)12-10(15)9-5-16-6-17-13(9)19-12/h1-6H,15H2 |
| InChIKey | YSMACAOBSQBKDQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone?
The IUPAC name of (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone (CID 165351345) is (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone.
What is the SMILES notation for (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone?
The canonical SMILES for (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone is Nc1c(C(=O)c2ccc(Cl)cc2)sc2ncncc12.
What is the InChIKey of (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone?
The InChIKey is YSMACAOBSQBKDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClN3OS/c14-8-3-1-7(2-4-8)11(18)12-10(15)9-5-16-6-17-13(9)19-12/h1-6H,15H2.
What are the key properties of (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone?
(5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone has a molecular weight of 289.75 g/mol, XLogP of 3.16, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-aminothieno[2,3-d]pyrimidin-6-yl)-(4-chlorophenyl)methanone is sourced from PubChem (CID 165351345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).