C13H14N4O3 — CID 165351380
N-[1-(5-methyl-1,2-oxazol-3-yl)propan-2-ylideneamino]-4-nitroaniline (PubChem CID 165351380) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is N-[1-(5-methyl-1,2-oxazol-3-yl)propan-2-ylideneamino]-4-nitroaniline.
| Compound Name | N-[1-(5-methyl-1,2-oxazol-3-yl)propan-2-ylideneamino]-4-nitroaniline |
|---|---|
| PubChem CID | 165351380 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-[1-(5-methyl-1,2-oxazol-3-yl)propan-2-ylideneamino]-4-nitroaniline |
| SMILES | CC(Cc1cc(C)on1)=NNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H14N4O3/c1-9(7-12-8-10(2)20-16-12)14-15-11-3-5-13(6-4-11)17(18)19/h3-6,8,15H,7H2,1-2H3 |
| InChIKey | XJGQKIJINHJFQG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|