C17H26 — CID 165351441
(2R,3S)-1,1,2,3,4,4,6-heptamethyl-2,3-dihydronaphthalene (PubChem CID 165351441) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is (2R,3S)-1,1,2,3,4,4,6-heptamethyl-2,3-dihydronaphthalene.
| Compound Name | (2R,3S)-1,1,2,3,4,4,6-heptamethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 165351441 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | (2R,3S)-1,1,2,3,4,4,6-heptamethyl-2,3-dihydronaphthalene |
| SMILES | Cc1ccc2c(c1)C(C)(C)[C@@H](C)[C@@H](C)C2(C)C |
| InChI | InChI=1S/C17H26/c1-11-8-9-14-15(10-11)17(6,7)13(3)12(2)16(14,4)5/h8-10,12-13H,1-7H3/t12-,13+/m1/s1 |
| InChIKey | NOVFDLLRGDSOJH-OLZOCXBDSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |