C19H16F3N3O4S2 — CID 165351769
2,4-bis[(4-aminophenyl)sulfonyl]-5-(trifluoromethyl)aniline (PubChem CID 165351769) has the molecular formula C19H16F3N3O4S2 and a molecular weight of 471.48 g/mol. Its IUPAC name is 2,4-bis[(4-aminophenyl)sulfonyl]-5-(trifluoromethyl)aniline.
| Compound Name | 2,4-bis[(4-aminophenyl)sulfonyl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 165351769 |
| Molecular Formula | C19H16F3N3O4S2 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.05 |
| IUPAC Name | 2,4-bis[(4-aminophenyl)sulfonyl]-5-(trifluoromethyl)aniline |
| SMILES | Nc1ccc(S(=O)(=O)c2cc(S(=O)(=O)c3ccc(N)cc3)c(C(F)(F)F)cc2N)cc1 |
| InChI | InChI=1S/C19H16F3N3O4S2/c20-19(21,22)15-9-16(25)18(31(28,29)14-7-3-12(24)4-8-14)10-17(15)30(26,27)13-5-1-11(23)2-6-13/h1-10H,23-25H2 |
| InChIKey | LIIAZMBQUGRJPX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|