About 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate
1-methylsulfanylpropan-2-yl thiolane-3-carboxylate (PubChem CID 165351992) has the molecular formula C9H16O2S2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate.
Molecular Properties
| Compound Name | 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate |
| PubChem CID | 165351992 |
| Molecular Formula | C9H16O2S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate |
| SMILES | CSCC(C)OC(=O)C1CCSC1 |
| InChI | InChI=1S/C9H16O2S2/c1-7(5-12-2)11-9(10)8-3-4-13-6-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | NMIZSCYIQHFFCN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate?
The IUPAC name of 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate (CID 165351992) is 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate.
What is the SMILES notation for 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate?
The canonical SMILES for 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate is CSCC(C)OC(=O)C1CCSC1.
What is the InChIKey of 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate?
The InChIKey is NMIZSCYIQHFFCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2S2/c1-7(5-12-2)11-9(10)8-3-4-13-6-8/h7-8H,3-6H2,1-2H3.
What are the key properties of 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate?
1-methylsulfanylpropan-2-yl thiolane-3-carboxylate has a molecular weight of 220.36 g/mol, XLogP of 2.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfanylpropan-2-yl thiolane-3-carboxylate is sourced from PubChem (CID 165351992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).