C18H30FNO3 — CID 165352076
(1R,3S)-3-amino-1-(2-fluoro-4-octoxyphenyl)butane-1,4-diol (PubChem CID 165352076) has the molecular formula C18H30FNO3 and a molecular weight of 327.44 g/mol. Its IUPAC name is (1R,3S)-3-amino-1-(2-fluoro-4-octoxyphenyl)butane-1,4-diol.
| Compound Name | (1R,3S)-3-amino-1-(2-fluoro-4-octoxyphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 165352076 |
| Molecular Formula | C18H30FNO3 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (1R,3S)-3-amino-1-(2-fluoro-4-octoxyphenyl)butane-1,4-diol |
| SMILES | CCCCCCCCOc1ccc([C@H](O)C[C@H](N)CO)c(F)c1 |
| InChI | InChI=1S/C18H30FNO3/c1-2-3-4-5-6-7-10-23-15-8-9-16(17(19)12-15)18(22)11-14(20)13-21/h8-9,12,14,18,21-22H,2-7,10-11,13,20H2,1H3/t14-,18+/m0/s1 |
| InChIKey | JZTQICHGZUSJQY-KBXCAEBGSA-N |
| XLogP | 3.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|