About 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde
5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde (PubChem CID 165352618) has the molecular formula C9H8N2O4
and a molecular weight of 208.17 g/mol. Its IUPAC name is 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde |
| PubChem CID | 165352618 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(C=NN2CCOC2=O)o1 |
| InChI | InChI=1S/C9H8N2O4/c12-6-8-2-1-7(15-8)5-10-11-3-4-14-9(11)13/h1-2,5-6H,3-4H2 |
| InChIKey | LXTYHEGBRZQFRB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde?
The IUPAC name of 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde (CID 165352618) is 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde.
What is the SMILES notation for 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde?
The canonical SMILES for 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde is O=Cc1ccc(C=NN2CCOC2=O)o1.
What is the InChIKey of 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde?
The InChIKey is LXTYHEGBRZQFRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4/c12-6-8-2-1-7(15-8)5-10-11-3-4-14-9(11)13/h1-2,5-6H,3-4H2.
What are the key properties of 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde?
5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde has a molecular weight of 208.17 g/mol, XLogP of 0.88, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-oxo-1,3-oxazolidin-3-yl)iminomethyl]furan-2-carbaldehyde is sourced from PubChem (CID 165352618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).