About 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine
2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine (PubChem CID 165353121) has the molecular formula C10H16BrNO
and a molecular weight of 246.15 g/mol. Its IUPAC name is 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine |
| PubChem CID | 165353121 |
| Molecular Formula | C10H16BrNO |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine |
| SMILES | CC(C)(C)C(C)(N)c1occc1Br |
| InChI | InChI=1S/C10H16BrNO/c1-9(2,3)10(4,12)8-7(11)5-6-13-8/h5-6H,12H2,1-4H3 |
| InChIKey | CZDGKIHBPQLIKV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine?
The IUPAC name of 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine (CID 165353121) is 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine.
What is the SMILES notation for 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine?
The canonical SMILES for 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine is CC(C)(C)C(C)(N)c1occc1Br.
What is the InChIKey of 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine?
The InChIKey is CZDGKIHBPQLIKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16BrNO/c1-9(2,3)10(4,12)8-7(11)5-6-13-8/h5-6H,12H2,1-4H3.
What are the key properties of 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine?
2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine has a molecular weight of 246.15 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromofuran-2-yl)-3,3-dimethylbutan-2-amine is sourced from PubChem (CID 165353121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).