About 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol
4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol (PubChem CID 165353670) has the molecular formula C16H21N3O
and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol.
Molecular Properties
| Compound Name | 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol |
| PubChem CID | 165353670 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol |
| SMILES | Cc1cc([C@@H]2CNCCN2)c(C)n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C16H21N3O/c1-11-9-15(16-10-17-7-8-18-16)12(2)19(11)13-3-5-14(20)6-4-13/h3-6,9,16-18,20H,7-8,10H2,1-2H3/t16-/m0/s1 |
| InChIKey | GDFPXGWYHJRUEK-INIZCTEOSA-N |
| XLogP | 2.03 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol?
The IUPAC name of 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol (CID 165353670) is 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol.
What is the SMILES notation for 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol?
The canonical SMILES for 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol is Cc1cc([C@@H]2CNCCN2)c(C)n1-c1ccc(O)cc1.
What is the InChIKey of 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol?
The InChIKey is GDFPXGWYHJRUEK-INIZCTEOSA-N. The full InChI is InChI=1S/C16H21N3O/c1-11-9-15(16-10-17-7-8-18-16)12(2)19(11)13-3-5-14(20)6-4-13/h3-6,9,16-18,20H,7-8,10H2,1-2H3/t16-/m0/s1.
What are the key properties of 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol?
4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol has a molecular weight of 271.36 g/mol, XLogP of 2.03, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,5-dimethyl-3-[(2R)-piperazin-2-yl]pyrrol-1-yl]phenol is sourced from PubChem (CID 165353670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).