About [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol
[4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol (PubChem CID 165353734) has the molecular formula C10H7FI2N2O
and a molecular weight of 443.99 g/mol. Its IUPAC name is [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol.
Molecular Properties
| Compound Name | [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol |
| PubChem CID | 165353734 |
| Molecular Formula | C10H7FI2N2O |
| Molecular Weight | 443.99 g/mol |
| Exact Mass | 443.86 |
| IUPAC Name | [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol |
| SMILES | OCc1ccc(-n2cnc(I)c2I)c(F)c1 |
| InChI | InChI=1S/C10H7FI2N2O/c11-7-3-6(4-16)1-2-8(7)15-5-14-9(12)10(15)13/h1-3,5,16H,4H2 |
| InChIKey | FJJUEBQOLBIZEI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.99 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol?
The IUPAC name of [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol (CID 165353734) is [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol.
What is the SMILES notation for [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol?
The canonical SMILES for [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol is OCc1ccc(-n2cnc(I)c2I)c(F)c1.
What is the InChIKey of [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol?
The InChIKey is FJJUEBQOLBIZEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FI2N2O/c11-7-3-6(4-16)1-2-8(7)15-5-14-9(12)10(15)13/h1-3,5,16H,4H2.
What are the key properties of [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol?
[4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol has a molecular weight of 443.99 g/mol, XLogP of 2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4,5-diiodoimidazol-1-yl)-3-fluorophenyl]methanol is sourced from PubChem (CID 165353734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).