C12H19N3O3 — CID 165354298
2-butyl-4-morpholin-4-yl-1H-pyridazine-3,6-dione (PubChem CID 165354298) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-butyl-4-morpholin-4-yl-1H-pyridazine-3,6-dione.
| Compound Name | 2-butyl-4-morpholin-4-yl-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 165354298 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-butyl-4-morpholin-4-yl-1H-pyridazine-3,6-dione |
| SMILES | CCCCn1[nH]c(=O)cc(N2CCOCC2)c1=O |
| InChI | InChI=1S/C12H19N3O3/c1-2-3-4-15-12(17)10(9-11(16)13-15)14-5-7-18-8-6-14/h9H,2-8H2,1H3,(H,13,16) |
| InChIKey | VEWVQCBUWUFDHJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |