About 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione
7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione (PubChem CID 165354550) has the molecular formula C10H9BrN2O2
and a molecular weight of 269.10 g/mol. Its IUPAC name is 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione |
| PubChem CID | 165354550 |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione |
| SMILES | CCC1C(=O)N=C2C=CC(Br)=CN2C1=O |
| InChI | InChI=1S/C10H9BrN2O2/c1-2-7-9(14)12-8-4-3-6(11)5-13(8)10(7)15/h3-5,7H,2H2,1H3 |
| InChIKey | SGYJQUJCIAGABZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione?
The IUPAC name of 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione (CID 165354550) is 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione.
What is the SMILES notation for 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione?
The canonical SMILES for 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione is CCC1C(=O)N=C2C=CC(Br)=CN2C1=O.
What is the InChIKey of 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione?
The InChIKey is SGYJQUJCIAGABZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O2/c1-2-7-9(14)12-8-4-3-6(11)5-13(8)10(7)15/h3-5,7H,2H2,1H3.
What are the key properties of 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione?
7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione has a molecular weight of 269.10 g/mol, XLogP of 1.59, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-ethylpyrido[1,2-a]pyrimidine-2,4-dione is sourced from PubChem (CID 165354550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).