C14H13NOS — CID 165354572
7-thiophen-2-yl-2,3,4,5-tetrahydro-2-benzazepin-1-one (PubChem CID 165354572) has the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. Its IUPAC name is 7-thiophen-2-yl-2,3,4,5-tetrahydro-2-benzazepin-1-one.
| Compound Name | 7-thiophen-2-yl-2,3,4,5-tetrahydro-2-benzazepin-1-one |
|---|---|
| PubChem CID | 165354572 |
| Molecular Formula | C14H13NOS |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 7-thiophen-2-yl-2,3,4,5-tetrahydro-2-benzazepin-1-one |
| SMILES | O=C1NCCCc2cc(-c3cccs3)ccc21 |
| InChI | InChI=1S/C14H13NOS/c16-14-12-6-5-11(13-4-2-8-17-13)9-10(12)3-1-7-15-14/h2,4-6,8-9H,1,3,7H2,(H,15,16) |
| InChIKey | PPGXTAFBANUTFJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |