C17H23NO — CID 165355240
N-methyl-N-phenyl-2-(2,3,3-trimethylcyclopenten-1-yl)acetamide (PubChem CID 165355240) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is N-methyl-N-phenyl-2-(2,3,3-trimethylcyclopenten-1-yl)acetamide.
| Compound Name | N-methyl-N-phenyl-2-(2,3,3-trimethylcyclopenten-1-yl)acetamide |
|---|---|
| PubChem CID | 165355240 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | N-methyl-N-phenyl-2-(2,3,3-trimethylcyclopenten-1-yl)acetamide |
| SMILES | CC1=C(CC(=O)N(C)c2ccccc2)CCC1(C)C |
| InChI | InChI=1S/C17H23NO/c1-13-14(10-11-17(13,2)3)12-16(19)18(4)15-8-6-5-7-9-15/h5-9H,10-12H2,1-4H3 |
| InChIKey | SBQJQDWPLRWISJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|