C8H8Cl2N2O — CID 165356359
2-(2,6-dichlorophenyl)-1-nitrosoethanamine (PubChem CID 165356359) has the molecular formula C8H8Cl2N2O and a molecular weight of 219.07 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-nitrosoethanamine.
| Compound Name | 2-(2,6-dichlorophenyl)-1-nitrosoethanamine |
|---|---|
| PubChem CID | 165356359 |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-nitrosoethanamine |
| SMILES | NC(Cc1c(Cl)cccc1Cl)N=O |
| InChI | InChI=1S/C8H8Cl2N2O/c9-6-2-1-3-7(10)5(6)4-8(11)12-13/h1-3,8H,4,11H2 |
| InChIKey | VTBPACDZYRRIJX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |