About 1,6-dimethyl-4,5-diphenylpyridin-2-one
1,6-dimethyl-4,5-diphenylpyridin-2-one (PubChem CID 165356437) has the molecular formula C19H17NO
and a molecular weight of 275.35 g/mol. Its IUPAC name is 1,6-dimethyl-4,5-diphenylpyridin-2-one.
Molecular Properties
| Compound Name | 1,6-dimethyl-4,5-diphenylpyridin-2-one |
| PubChem CID | 165356437 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1,6-dimethyl-4,5-diphenylpyridin-2-one |
| SMILES | Cc1c(-c2ccccc2)c(-c2ccccc2)cc(=O)n1C |
| InChI | InChI=1S/C19H17NO/c1-14-19(16-11-7-4-8-12-16)17(13-18(21)20(14)2)15-9-5-3-6-10-15/h3-13H,1-2H3 |
| InChIKey | XKQAWLNYOBOLLE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,6-dimethyl-4,5-diphenylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-4,5-diphenylpyridin-2-one?
The IUPAC name of 1,6-dimethyl-4,5-diphenylpyridin-2-one (CID 165356437) is 1,6-dimethyl-4,5-diphenylpyridin-2-one.
What is the SMILES notation for 1,6-dimethyl-4,5-diphenylpyridin-2-one?
The canonical SMILES for 1,6-dimethyl-4,5-diphenylpyridin-2-one is Cc1c(-c2ccccc2)c(-c2ccccc2)cc(=O)n1C.
What is the InChIKey of 1,6-dimethyl-4,5-diphenylpyridin-2-one?
The InChIKey is XKQAWLNYOBOLLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO/c1-14-19(16-11-7-4-8-12-16)17(13-18(21)20(14)2)15-9-5-3-6-10-15/h3-13H,1-2H3.
What are the key properties of 1,6-dimethyl-4,5-diphenylpyridin-2-one?
1,6-dimethyl-4,5-diphenylpyridin-2-one has a molecular weight of 275.35 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-4,5-diphenylpyridin-2-one is sourced from PubChem (CID 165356437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).