C8H8O4 — CID 165356449
(3Z,7Z)-4,8-dimethyl-1,5-dioxocine-2,6-dione (PubChem CID 165356449) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is (3Z,7Z)-4,8-dimethyl-1,5-dioxocine-2,6-dione.
| Compound Name | (3Z,7Z)-4,8-dimethyl-1,5-dioxocine-2,6-dione |
|---|---|
| PubChem CID | 165356449 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (3Z,7Z)-4,8-dimethyl-1,5-dioxocine-2,6-dione |
| SMILES | C/C1=C/C(=O)O/C(C)=C\C(=O)O1 |
| InChI | InChI=1S/C8H8O4/c1-5-3-7(9)12-6(2)4-8(10)11-5/h3-4H,1-2H3/b5-3-,6-4- |
| InChIKey | IRJYRSLJMWVIKX-GLIMQPGKSA-N |
| XLogP | 0.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |