C16H13N — CID 165356495
tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13,15-heptaen-4-amine (PubChem CID 165356495) has the molecular formula C16H13N and a molecular weight of 219.29 g/mol. Its IUPAC name is tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13,15-heptaen-4-amine.
| Compound Name | tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13,15-heptaen-4-amine |
|---|---|
| PubChem CID | 165356495 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | tetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13,15-heptaen-4-amine |
| SMILES | Nc1ccc2c(c1)C1C=CC2c2ccccc21 |
| InChI | InChI=1S/C16H13N/c17-10-5-6-14-13-7-8-15(16(14)9-10)12-4-2-1-3-11(12)13/h1-9,13,15H,17H2 |
| InChIKey | JKDBJLUWZPQJBX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|