About (2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl
(2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl (PubChem CID 165356532) has the molecular formula C18H29O2
and a molecular weight of 277.43 g/mol.
Molecular Properties
| Compound Name | (2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl |
| PubChem CID | 165356532 |
| Molecular Formula | C18H29O2 |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | — |
| SMILES | CC(C)(C)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1[O] |
| InChI | InChI=1S/C18H29O2/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)20-18(7,8)9/h10-11H,1-9H3 |
| InChIKey | ROIKSFMQTDPHAL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl?
The IUPAC name of (2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl (CID 165356532) is not available.
What is the SMILES notation for (2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl?
The canonical SMILES for (2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl is CC(C)(C)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1[O].
What is the InChIKey of (2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl?
The InChIKey is ROIKSFMQTDPHAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29O2/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)20-18(7,8)9/h10-11H,1-9H3.
What are the key properties of (2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl?
(2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl has a molecular weight of 277.43 g/mol, XLogP of 5.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-Butoxy-4,6-di-tert-butylphenyl)oxidanyl is sourced from PubChem (CID 165356532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).