About 3-methyl-2,4-bis(phenyldiazenyl)phenol
3-methyl-2,4-bis(phenyldiazenyl)phenol (PubChem CID 165356991) has the molecular formula C19H16N4O
and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-methyl-2,4-bis(phenyldiazenyl)phenol.
Molecular Properties
| Compound Name | 3-methyl-2,4-bis(phenyldiazenyl)phenol |
| PubChem CID | 165356991 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-methyl-2,4-bis(phenyldiazenyl)phenol |
| SMILES | Cc1c(/N=N/c2ccccc2)ccc(O)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C19H16N4O/c1-14-17(22-20-15-8-4-2-5-9-15)12-13-18(24)19(14)23-21-16-10-6-3-7-11-16/h2-13,24H,1H3/b22-20+,23-21+ |
| InChIKey | KVIFHLKSVCIYTG-DQPVQCHKSA-N |
| XLogP | 6.53 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2,4-bis(phenyldiazenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,4-bis(phenyldiazenyl)phenol?
The IUPAC name of 3-methyl-2,4-bis(phenyldiazenyl)phenol (CID 165356991) is 3-methyl-2,4-bis(phenyldiazenyl)phenol.
What is the SMILES notation for 3-methyl-2,4-bis(phenyldiazenyl)phenol?
The canonical SMILES for 3-methyl-2,4-bis(phenyldiazenyl)phenol is Cc1c(/N=N/c2ccccc2)ccc(O)c1/N=N/c1ccccc1.
What is the InChIKey of 3-methyl-2,4-bis(phenyldiazenyl)phenol?
The InChIKey is KVIFHLKSVCIYTG-DQPVQCHKSA-N. The full InChI is InChI=1S/C19H16N4O/c1-14-17(22-20-15-8-4-2-5-9-15)12-13-18(24)19(14)23-21-16-10-6-3-7-11-16/h2-13,24H,1H3/b22-20+,23-21+.
What are the key properties of 3-methyl-2,4-bis(phenyldiazenyl)phenol?
3-methyl-2,4-bis(phenyldiazenyl)phenol has a molecular weight of 316.36 g/mol, XLogP of 6.53, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,4-bis(phenyldiazenyl)phenol is sourced from PubChem (CID 165356991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).