About (E)-2,3-difluorobut-2-ene-1,4-diol
(E)-2,3-difluorobut-2-ene-1,4-diol (PubChem CID 165358229) has the molecular formula C4H6F2O2
and a molecular weight of 124.09 g/mol. Its IUPAC name is (E)-2,3-difluorobut-2-ene-1,4-diol.
Molecular Properties
| Compound Name | (E)-2,3-difluorobut-2-ene-1,4-diol |
| PubChem CID | 165358229 |
| Molecular Formula | C4H6F2O2 |
| Molecular Weight | 124.09 g/mol |
| Exact Mass | 124.03 |
| IUPAC Name | (E)-2,3-difluorobut-2-ene-1,4-diol |
| SMILES | OC/C(F)=C(\F)CO |
| InChI | InChI=1S/C4H6F2O2/c5-3(1-7)4(6)2-8/h7-8H,1-2H2/b4-3+ |
| InChIKey | LKWLDHFUFZAPTA-ONEGZZNKSA-N |
| XLogP | 0.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.09 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-2,3-difluorobut-2-ene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-difluorobut-2-ene-1,4-diol?
The IUPAC name of (E)-2,3-difluorobut-2-ene-1,4-diol (CID 165358229) is (E)-2,3-difluorobut-2-ene-1,4-diol.
What is the SMILES notation for (E)-2,3-difluorobut-2-ene-1,4-diol?
The canonical SMILES for (E)-2,3-difluorobut-2-ene-1,4-diol is OC/C(F)=C(\F)CO.
What is the InChIKey of (E)-2,3-difluorobut-2-ene-1,4-diol?
The InChIKey is LKWLDHFUFZAPTA-ONEGZZNKSA-N. The full InChI is InChI=1S/C4H6F2O2/c5-3(1-7)4(6)2-8/h7-8H,1-2H2/b4-3+.
What are the key properties of (E)-2,3-difluorobut-2-ene-1,4-diol?
(E)-2,3-difluorobut-2-ene-1,4-diol has a molecular weight of 124.09 g/mol, XLogP of 0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-difluorobut-2-ene-1,4-diol is sourced from PubChem (CID 165358229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).