(3-iodophenyl)phosphonic acid

C6H6IO3P — CID 165358645

IUPAC(3-iodophenyl)phosphonic acid
SMILESO=P(O)(O)c1cccc(I)c1
InChIInChI=1S/C6H6IO3P/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H,(H2,8,9,10)
InChIKeyUMWSLBGRTFMVHW-UHFFFAOYSA-N
MW283.99 g/mol
LogP1.09
Rot. Bonds1

About (3-iodophenyl)phosphonic acid

(3-iodophenyl)phosphonic acid (PubChem CID 165358645) has the molecular formula C6H6IO3P and a molecular weight of 283.99 g/mol. Its IUPAC name is (3-iodophenyl)phosphonic acid.

Molecular Properties

Compound Name(3-iodophenyl)phosphonic acid
PubChem CID165358645
Molecular FormulaC6H6IO3P
Molecular Weight283.99 g/mol
Exact Mass283.91
IUPAC Name(3-iodophenyl)phosphonic acid
SMILESO=P(O)(O)c1cccc(I)c1
InChIInChI=1S/C6H6IO3P/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H,(H2,8,9,10)
InChIKeyUMWSLBGRTFMVHW-UHFFFAOYSA-N
XLogP1.09
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.99
LogP ≤ 51.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (3-iodophenyl)phosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-iodophenyl)phosphonic acid?
The IUPAC name of (3-iodophenyl)phosphonic acid (CID 165358645) is (3-iodophenyl)phosphonic acid.
What is the SMILES notation for (3-iodophenyl)phosphonic acid?
The canonical SMILES for (3-iodophenyl)phosphonic acid is O=P(O)(O)c1cccc(I)c1.
What is the InChIKey of (3-iodophenyl)phosphonic acid?
The InChIKey is UMWSLBGRTFMVHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6IO3P/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H,(H2,8,9,10).
What are the key properties of (3-iodophenyl)phosphonic acid?
(3-iodophenyl)phosphonic acid has a molecular weight of 283.99 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodophenyl)phosphonic acid is sourced from PubChem (CID 165358645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).