C21H38O7 — CID 165359326
(3R,4S,5S,6R,7R,9R,11R,12S,13R)-14-ethyl-4,6,7,12-tetrahydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione (PubChem CID 165359326) has the molecular formula C21H38O7 and a molecular weight of 402.53 g/mol. Its IUPAC name is (3R,4S,5S,6R,7R,9R,11R,12S,13R)-14-ethyl-4,6,7,12-tetrahydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (3R,4S,5S,6R,7R,9R,11R,12S,13R)-14-ethyl-4,6,7,12-tetrahydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 165359326 |
| Molecular Formula | C21H38O7 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (3R,4S,5S,6R,7R,9R,11R,12S,13R)-14-ethyl-4,6,7,12-tetrahydroxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecane-2,10-dione |
| SMILES | CCC1OC(=O)[C@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@](C)(O)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C21H38O7/c1-8-15-11(3)17(23)12(4)16(22)10(2)9-21(7,27)19(25)13(5)18(24)14(6)20(26)28-15/h10-15,17-19,23-25,27H,8-9H2,1-7H3/t10-,11+,12+,13+,14-,15?,17+,18+,19-,21-/m1/s1 |
| InChIKey | ZFBRGCCVTUPRFQ-MKDWRNIRSA-N |
| XLogP | 1.30 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |