C14H18N2O7S — CID 165359490
4-[2-[(1S)-1-carboxy-3-methylsulfinylpropyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid (PubChem CID 165359490) has the molecular formula C14H18N2O7S and a molecular weight of 358.37 g/mol. Its IUPAC name is 4-[2-[(1S)-1-carboxy-3-methylsulfinylpropyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid.
| Compound Name | 4-[2-[(1S)-1-carboxy-3-methylsulfinylpropyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 165359490 |
| Molecular Formula | C14H18N2O7S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 4-[2-[(1S)-1-carboxy-3-methylsulfinylpropyl]iminoethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid |
| SMILES | CS(=O)CC[C@H](/N=C/C=C1C=C(C(=O)O)NC(C(=O)O)C1)C(=O)O |
| InChI | InChI=1S/C14H18N2O7S/c1-24(23)5-3-9(12(17)18)15-4-2-8-6-10(13(19)20)16-11(7-8)14(21)22/h2,4,6,9,11,16H,3,5,7H2,1H3,(H,17,18)(H,19,20)(H,21,22)/b8-2?,15-4+/t9-,11?,24?/m0/s1 |
| InChIKey | KRWNKOCPQBHMPM-HOQVTISYSA-N |
| XLogP | -0.38 |
| TPSA | 153.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|