About 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride
1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride (PubChem CID 165360652) has the molecular formula C10H13Cl3O2
and a molecular weight of 271.57 g/mol. Its IUPAC name is 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride.
Molecular Properties
| Compound Name | 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride |
| PubChem CID | 165360652 |
| Molecular Formula | C10H13Cl3O2 |
| Molecular Weight | 271.57 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride |
| SMILES | COc1c(C)c(C)c(Cl)c(Cl)c1OC.Cl |
| InChI | InChI=1S/C10H12Cl2O2.ClH/c1-5-6(2)9(13-3)10(14-4)8(12)7(5)11;/h1-4H3;1H |
| InChIKey | OEAVEMKSSYTYGA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride?
The IUPAC name of 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride (CID 165360652) is 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride.
What is the SMILES notation for 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride?
The canonical SMILES for 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride is COc1c(C)c(C)c(Cl)c(Cl)c1OC.Cl.
What is the InChIKey of 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride?
The InChIKey is OEAVEMKSSYTYGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Cl2O2.ClH/c1-5-6(2)9(13-3)10(14-4)8(12)7(5)11;/h1-4H3;1H.
What are the key properties of 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride?
1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride has a molecular weight of 271.57 g/mol, XLogP of 4.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-3,4-dimethoxy-5,6-dimethylbenzene;hydrochloride is sourced from PubChem (CID 165360652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).