C9H17O9P — CID 165361288
2-[1-carboxyethoxy(1-hydroxypropan-2-yloxy)phosphoryl]oxypropanoic acid (PubChem CID 165361288) has the molecular formula C9H17O9P and a molecular weight of 300.20 g/mol. Its IUPAC name is 2-[1-carboxyethoxy(1-hydroxypropan-2-yloxy)phosphoryl]oxypropanoic acid.
| Compound Name | 2-[1-carboxyethoxy(1-hydroxypropan-2-yloxy)phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 165361288 |
| Molecular Formula | C9H17O9P |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[1-carboxyethoxy(1-hydroxypropan-2-yloxy)phosphoryl]oxypropanoic acid |
| SMILES | CC(CO)OP(=O)(OC(C)C(=O)O)OC(C)C(=O)O |
| InChI | InChI=1S/C9H17O9P/c1-5(4-10)16-19(15,17-6(2)8(11)12)18-7(3)9(13)14/h5-7,10H,4H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | UBZAGZILEIMIIF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|