About N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide
N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide (PubChem CID 165362012) has the molecular formula C15H18F3NO2
and a molecular weight of 301.31 g/mol. Its IUPAC name is N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide.
Molecular Properties
| Compound Name | N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide |
| PubChem CID | 165362012 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide |
| SMILES | CCCC(C(=O)c1ccccc1)N(CC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO2/c1-3-8-12(13(20)11-9-6-5-7-10-11)19(4-2)14(21)15(16,17)18/h5-7,9-10,12H,3-4,8H2,1-2H3 |
| InChIKey | VEPKBNDRHULGNT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide?
The IUPAC name of N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide (CID 165362012) is N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide.
What is the SMILES notation for N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide?
The canonical SMILES for N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide is CCCC(C(=O)c1ccccc1)N(CC)C(=O)C(F)(F)F.
What is the InChIKey of N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide?
The InChIKey is VEPKBNDRHULGNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3NO2/c1-3-8-12(13(20)11-9-6-5-7-10-11)19(4-2)14(21)15(16,17)18/h5-7,9-10,12H,3-4,8H2,1-2H3.
What are the key properties of N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide?
N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide has a molecular weight of 301.31 g/mol, XLogP of 3.45, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpentan-2-yl)acetamide is sourced from PubChem (CID 165362012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).