C18H10F13IO3S — CID 165362326
diphenyliodanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate (PubChem CID 165362326) has the molecular formula C18H10F13IO3S and a molecular weight of 680.22 g/mol. Its IUPAC name is diphenyliodanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate.
| Compound Name | diphenyliodanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 165362326 |
| Molecular Formula | C18H10F13IO3S |
| Molecular Weight | 680.22 g/mol |
| Exact Mass | 679.92 |
| IUPAC Name | diphenyliodanium;1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc([I+]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10I.C6HF13O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22/h1-10H;(H,20,21,22)/q+1;/p-1 |
| InChIKey | PIHZJOWYGQFDSU-UHFFFAOYSA-M |
| XLogP | 3.04 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|