C48H28F26O6S5 — CID 165362334
[4-(4-diphenylsulfoniophenyl)sulfanylphenyl]-diphenylsulfanium;bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate) (PubChem CID 165362334) has the molecular formula C48H28F26O6S5 and a molecular weight of 1355.03 g/mol. Its IUPAC name is [4-(4-diphenylsulfoniophenyl)sulfanylphenyl]-diphenylsulfanium;bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate).
| Compound Name | [4-(4-diphenylsulfoniophenyl)sulfanylphenyl]-diphenylsulfanium;bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate) |
|---|---|
| PubChem CID | 165362334 |
| Molecular Formula | C48H28F26O6S5 |
| Molecular Weight | 1355.03 g/mol |
| Exact Mass | 1354.01 |
| IUPAC Name | [4-(4-diphenylsulfoniophenyl)sulfanylphenyl]-diphenylsulfanium;bis(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate) |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccc(Sc3ccc([S+](c4ccccc4)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H28S3.2C6HF13O3S/c1-5-13-31(14-6-1)38(32-15-7-2-8-16-32)35-25-21-29(22-26-35)37-30-23-27-36(28-24-30)39(33-17-9-3-10-18-33)34-19-11-4-12-20-34;2*7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22/h1-28H;2*(H,20,21,22)/q+2;;/p-2 |
| InChIKey | KIVAZSOOGCFOFV-UHFFFAOYSA-L |
| XLogP | 16.48 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1355.03 |
| LogP ≤ 5 | 16.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|