C36H39F13O3S2 — CID 165362336
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate;tris(4-tert-butylphenyl)sulfanium (PubChem CID 165362336) has the molecular formula C36H39F13O3S2 and a molecular weight of 830.81 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate;tris(4-tert-butylphenyl)sulfanium.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate;tris(4-tert-butylphenyl)sulfanium |
|---|---|
| PubChem CID | 165362336 |
| Molecular Formula | C36H39F13O3S2 |
| Molecular Weight | 830.81 g/mol |
| Exact Mass | 830.21 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonate;tris(4-tert-butylphenyl)sulfanium |
| SMILES | CC(C)(C)c1ccc([S+](c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H39S.C6HF13O3S/c1-28(2,3)22-10-16-25(17-11-22)31(26-18-12-23(13-19-26)29(4,5)6)27-20-14-24(15-21-27)30(7,8)9;7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22/h10-21H,1-9H3;(H,20,21,22)/q+1;/p-1 |
| InChIKey | CYGRQLSJULUVIA-UHFFFAOYSA-M |
| XLogP | 11.90 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.81 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|