C33H64O3Si3 — CID 165362380
trimethyl-[3-[(1R,2R,4R)-2-[4-(2-methyloctan-2-yl)-2-trimethylsilyloxyphenyl]-4-trimethylsilyloxycyclohexyl]propoxy]silane (PubChem CID 165362380) has the molecular formula C33H64O3Si3 and a molecular weight of 593.13 g/mol. Its IUPAC name is trimethyl-[3-[(1R,2R,4R)-2-[4-(2-methyloctan-2-yl)-2-trimethylsilyloxyphenyl]-4-trimethylsilyloxycyclohexyl]propoxy]silane.
| Compound Name | trimethyl-[3-[(1R,2R,4R)-2-[4-(2-methyloctan-2-yl)-2-trimethylsilyloxyphenyl]-4-trimethylsilyloxycyclohexyl]propoxy]silane |
|---|---|
| PubChem CID | 165362380 |
| Molecular Formula | C33H64O3Si3 |
| Molecular Weight | 593.13 g/mol |
| Exact Mass | 592.42 |
| IUPAC Name | trimethyl-[3-[(1R,2R,4R)-2-[4-(2-methyloctan-2-yl)-2-trimethylsilyloxyphenyl]-4-trimethylsilyloxycyclohexyl]propoxy]silane |
| SMILES | CCCCCCC(C)(C)c1ccc([C@@H]2C[C@H](O[Si](C)(C)C)CC[C@H]2CCCO[Si](C)(C)C)c(O[Si](C)(C)C)c1 |
| InChI | InChI=1S/C33H64O3Si3/c1-13-14-15-16-23-33(2,3)28-20-22-30(32(25-28)36-39(10,11)12)31-26-29(35-38(7,8)9)21-19-27(31)18-17-24-34-37(4,5)6/h20,22,25,27,29,31H,13-19,21,23-24,26H2,1-12H3/t27-,29-,31-/m1/s1 |
| InChIKey | AGOIKXSOUBIFCG-MPGAWZFDSA-N |
| XLogP | 10.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.13 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|