C15H22BrClN2O — CID 165362467
4-bromo-N-[(1S,2S)-2-(dimethylamino)cyclohexyl]benzamide;hydrochloride (PubChem CID 165362467) has the molecular formula C15H22BrClN2O and a molecular weight of 361.71 g/mol. Its IUPAC name is 4-bromo-N-[(1S,2S)-2-(dimethylamino)cyclohexyl]benzamide;hydrochloride.
| Compound Name | 4-bromo-N-[(1S,2S)-2-(dimethylamino)cyclohexyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 165362467 |
| Molecular Formula | C15H22BrClN2O |
| Molecular Weight | 361.71 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 4-bromo-N-[(1S,2S)-2-(dimethylamino)cyclohexyl]benzamide;hydrochloride |
| SMILES | CN(C)[C@H]1CCCC[C@@H]1NC(=O)c1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C15H21BrN2O.ClH/c1-18(2)14-6-4-3-5-13(14)17-15(19)11-7-9-12(16)10-8-11;/h7-10,13-14H,3-6H2,1-2H3,(H,17,19);1H/t13-,14-;/m0./s1 |
| InChIKey | ATYJDUHKGPBKFS-IODNYQNNSA-N |
| XLogP | 3.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |